C15H27NO — CID 143456439
2-(cyclohexa-1,5-dien-1-ylmethoxy)cyclohexan-1-amine;ethane (PubChem CID 143456439) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 2-(cyclohexa-1,5-dien-1-ylmethoxy)cyclohexan-1-amine;ethane.
| Compound Name | 2-(cyclohexa-1,5-dien-1-ylmethoxy)cyclohexan-1-amine;ethane |
|---|---|
| PubChem CID | 143456439 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 2-(cyclohexa-1,5-dien-1-ylmethoxy)cyclohexan-1-amine;ethane |
| SMILES | CC.NC1CCCCC1OCC1=CCCC=C1 |
| InChI | InChI=1S/C13H21NO.C2H6/c14-12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11;1-2/h2,6-7,12-13H,1,3-5,8-10,14H2;1-2H3 |
| InChIKey | ZWFPMPBNJDVLOJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |