C11H12O2 — CID 143309985
2,3,4,8-tetrahydrocyclohepta[b]pyran-8-carbaldehyde (PubChem CID 143309985) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is 2,3,4,8-tetrahydrocyclohepta[b]pyran-8-carbaldehyde.
| Compound Name | 2,3,4,8-tetrahydrocyclohepta[b]pyran-8-carbaldehyde |
|---|---|
| PubChem CID | 143309985 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 2,3,4,8-tetrahydrocyclohepta[b]pyran-8-carbaldehyde |
| SMILES | O=CC1C=CC=C2CCCOC2=C1 |
| InChI | InChI=1S/C11H12O2/c12-8-9-3-1-4-10-5-2-6-13-11(10)7-9/h1,3-4,7-9H,2,5-6H2 |
| InChIKey | UWCCFMQUVWHBLT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|