C20H23ClN2O2S — CID 143311261
[6-[[(2-chloro-6-methylphenyl)-methylidene-oxo-λ6-sulfanyl]methyl]-2-pyridinyl]-piperidin-1-ylmethanone (PubChem CID 143311261) has the molecular formula C20H23ClN2O2S and a molecular weight of 390.94 g/mol. Its IUPAC name is [6-[[(2-chloro-6-methylphenyl)-methylidene-oxo-λ6-sulfanyl]methyl]-2-pyridinyl]-piperidin-1-ylmethanone.
| Compound Name | [6-[[(2-chloro-6-methylphenyl)-methylidene-oxo-λ6-sulfanyl]methyl]-2-pyridinyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 143311261 |
| Molecular Formula | C20H23ClN2O2S |
| Molecular Weight | 390.94 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [6-[[(2-chloro-6-methylphenyl)-methylidene-oxo-λ6-sulfanyl]methyl]-2-pyridinyl]-piperidin-1-ylmethanone |
| SMILES | C=S(=O)(Cc1cccc(C(=O)N2CCCCC2)n1)c1c(C)cccc1Cl |
| InChI | InChI=1S/C20H23ClN2O2S/c1-15-8-6-10-17(21)19(15)26(2,25)14-16-9-7-11-18(22-16)20(24)23-12-4-3-5-13-23/h6-11H,2-5,12-14H2,1H3 |
| InChIKey | QREZBFKECUSKMG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.94 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|