C20H21Cl3N2O3S — CID 58211317
(3,3-dimethylpiperidin-1-yl)-[6-[(2,4,5-trichlorophenyl)sulfonylmethyl]-2-pyridinyl]methanone (PubChem CID 58211317) has the molecular formula C20H21Cl3N2O3S and a molecular weight of 475.83 g/mol. Its IUPAC name is (3,3-dimethylpiperidin-1-yl)-[6-[(2,4,5-trichlorophenyl)sulfonylmethyl]-2-pyridinyl]methanone.
| Compound Name | (3,3-dimethylpiperidin-1-yl)-[6-[(2,4,5-trichlorophenyl)sulfonylmethyl]-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 58211317 |
| Molecular Formula | C20H21Cl3N2O3S |
| Molecular Weight | 475.83 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | (3,3-dimethylpiperidin-1-yl)-[6-[(2,4,5-trichlorophenyl)sulfonylmethyl]-2-pyridinyl]methanone |
| SMILES | CC1(C)CCCN(C(=O)c2cccc(CS(=O)(=O)c3cc(Cl)c(Cl)cc3Cl)n2)C1 |
| InChI | InChI=1S/C20H21Cl3N2O3S/c1-20(2)7-4-8-25(12-20)19(26)17-6-3-5-13(24-17)11-29(27,28)18-10-15(22)14(21)9-16(18)23/h3,5-6,9-10H,4,7-8,11-12H2,1-2H3 |
| InChIKey | HBTIXEYNKGZPOK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.83 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|