C7H8FN — CID 143312681
3-fluorocyclohepta-1,3,6-trien-1-amine (PubChem CID 143312681) has the molecular formula C7H8FN and a molecular weight of 125.15 g/mol. Its IUPAC name is 3-fluorocyclohepta-1,3,6-trien-1-amine.
| Compound Name | 3-fluorocyclohepta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 143312681 |
| Molecular Formula | C7H8FN |
| Molecular Weight | 125.15 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | 3-fluorocyclohepta-1,3,6-trien-1-amine |
| SMILES | NC1=CC(F)=CCC=C1 |
| InChI | InChI=1S/C7H8FN/c8-6-3-1-2-4-7(9)5-6/h2-5H,1,9H2 |
| InChIKey | BQTOXOHYYOJXCU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.15 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |