C7H11F2N — CID 89074111
(3E)-6,7-difluorohepta-1,3-dien-3-amine (PubChem CID 89074111) has the molecular formula C7H11F2N and a molecular weight of 147.17 g/mol. Its IUPAC name is (3E)-6,7-difluorohepta-1,3-dien-3-amine.
| Compound Name | (3E)-6,7-difluorohepta-1,3-dien-3-amine |
|---|---|
| PubChem CID | 89074111 |
| Molecular Formula | C7H11F2N |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | (3E)-6,7-difluorohepta-1,3-dien-3-amine |
| SMILES | C=C/C(N)=C\CC(F)CF |
| InChI | InChI=1S/C7H11F2N/c1-2-7(10)4-3-6(9)5-8/h2,4,6H,1,3,5,10H2/b7-4+ |
| InChIKey | NKLVOCYWDFICGE-QPJJXVBHSA-N |
| XLogP | 1.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|