C23H27ClN2O2 — CID 143312889
ethyl 4-(2-amino-5-chlorophenyl)-6-(2-phenylpropyl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 143312889) has the molecular formula C23H27ClN2O2 and a molecular weight of 398.93 g/mol. Its IUPAC name is ethyl 4-(2-amino-5-chlorophenyl)-6-(2-phenylpropyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | ethyl 4-(2-amino-5-chlorophenyl)-6-(2-phenylpropyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 143312889 |
| Molecular Formula | C23H27ClN2O2 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | ethyl 4-(2-amino-5-chlorophenyl)-6-(2-phenylpropyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(c2cc(Cl)ccc2N)=CC1CC(C)c1ccccc1 |
| InChI | InChI=1S/C23H27ClN2O2/c1-3-28-23(27)26-12-11-18(21-15-19(24)9-10-22(21)25)14-20(26)13-16(2)17-7-5-4-6-8-17/h4-10,14-16,20H,3,11-13,25H2,1-2H3 |
| InChIKey | QDDSCTRCUNNFSP-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|