C27H39NO4 — CID 143314102
N-[4-[4-[3-(dihydroxymethyl)-6-methylheptanoyl]phenyl]-4-methylcyclohexa-1,5-dien-1-yl]pentanamide (PubChem CID 143314102) has the molecular formula C27H39NO4 and a molecular weight of 441.61 g/mol. Its IUPAC name is N-[4-[4-[3-(dihydroxymethyl)-6-methylheptanoyl]phenyl]-4-methylcyclohexa-1,5-dien-1-yl]pentanamide.
| Compound Name | N-[4-[4-[3-(dihydroxymethyl)-6-methylheptanoyl]phenyl]-4-methylcyclohexa-1,5-dien-1-yl]pentanamide |
|---|---|
| PubChem CID | 143314102 |
| Molecular Formula | C27H39NO4 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | N-[4-[4-[3-(dihydroxymethyl)-6-methylheptanoyl]phenyl]-4-methylcyclohexa-1,5-dien-1-yl]pentanamide |
| SMILES | CCCCC(=O)NC1=CCC(C)(c2ccc(C(=O)CC(CCC(C)C)C(O)O)cc2)C=C1 |
| InChI | InChI=1S/C27H39NO4/c1-5-6-7-25(30)28-23-14-16-27(4,17-15-23)22-12-10-20(11-13-22)24(29)18-21(26(31)32)9-8-19(2)3/h10-16,19,21,26,31-32H,5-9,17-18H2,1-4H3,(H,28,30) |
| InChIKey | DVEUFOOJUULIBZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|