C31H28N2O5 — CID 143314528
4-[4-[4-[(2-ethoxyphenyl)carbamoylamino]phenyl]phenyl]-4-oxo-2-phenylbutanoic acid (PubChem CID 143314528) has the molecular formula C31H28N2O5 and a molecular weight of 508.57 g/mol. Its IUPAC name is 4-[4-[4-[(2-ethoxyphenyl)carbamoylamino]phenyl]phenyl]-4-oxo-2-phenylbutanoic acid.
| Compound Name | 4-[4-[4-[(2-ethoxyphenyl)carbamoylamino]phenyl]phenyl]-4-oxo-2-phenylbutanoic acid |
|---|---|
| PubChem CID | 143314528 |
| Molecular Formula | C31H28N2O5 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 4-[4-[4-[(2-ethoxyphenyl)carbamoylamino]phenyl]phenyl]-4-oxo-2-phenylbutanoic acid |
| SMILES | CCOc1ccccc1NC(=O)Nc1ccc(-c2ccc(C(=O)CC(C(=O)O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H28N2O5/c1-2-38-29-11-7-6-10-27(29)33-31(37)32-25-18-16-22(17-19-25)21-12-14-24(15-13-21)28(34)20-26(30(35)36)23-8-4-3-5-9-23/h3-19,26H,2,20H2,1H3,(H,35,36)(H2,32,33,37) |
| InChIKey | UFEQEIADJVXTON-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |