C29H48N4O5 — CID 143314595
formaldehyde;3-[[(2S)-3-[(2S)-2-formamido-2-(1-methylcyclohexyl)acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]methylamino]-2-oxo-N-prop-2-enylheptanamide (PubChem CID 143314595) has the molecular formula C29H48N4O5 and a molecular weight of 532.73 g/mol. Its IUPAC name is formaldehyde;3-[[(2S)-3-[(2S)-2-formamido-2-(1-methylcyclohexyl)acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]methylamino]-2-oxo-N-prop-2-enylheptanamide.
| Compound Name | formaldehyde;3-[[(2S)-3-[(2S)-2-formamido-2-(1-methylcyclohexyl)acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]methylamino]-2-oxo-N-prop-2-enylheptanamide |
|---|---|
| PubChem CID | 143314595 |
| Molecular Formula | C29H48N4O5 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.36 |
| IUPAC Name | formaldehyde;3-[[(2S)-3-[(2S)-2-formamido-2-(1-methylcyclohexyl)acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]methylamino]-2-oxo-N-prop-2-enylheptanamide |
| SMILES | C=CCNC(=O)C(=O)C(CCCC)NC[C@@H]1C2C(CN1C(=O)[C@@H](NC=O)C1(C)CCCCC1)C2(C)C.C=O |
| InChI | InChI=1S/C28H46N4O4.CH2O/c1-6-8-12-20(23(34)25(35)29-15-7-2)30-16-21-22-19(27(22,3)4)17-32(21)26(36)24(31-18-33)28(5)13-10-9-11-14-28;1-2/h7,18-22,24,30H,2,6,8-17H2,1,3-5H3,(H,29,35)(H,31,33);1H2/t19?,20?,21-,22?,24-;/m1./s1 |
| InChIKey | NKYOTKKFHYPUNM-KGTQRZRBSA-N |
| XLogP | 2.39 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|