C25H38N4O5 — CID 58821439
(1R,2S,5S)-N-[1,2-dioxo-1-(prop-2-enylamino)heptan-3-yl]-3-[(2R)-2-isocyanato-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 58821439) has the molecular formula C25H38N4O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is (1R,2S,5S)-N-[1,2-dioxo-1-(prop-2-enylamino)heptan-3-yl]-3-[(2R)-2-isocyanato-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-[1,2-dioxo-1-(prop-2-enylamino)heptan-3-yl]-3-[(2R)-2-isocyanato-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 58821439 |
| Molecular Formula | C25H38N4O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | (1R,2S,5S)-N-[1,2-dioxo-1-(prop-2-enylamino)heptan-3-yl]-3-[(2R)-2-isocyanato-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | C=CCNC(=O)C(=O)C(CCCC)NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@H](N=C=O)C(C)(C)C)C2(C)C |
| InChI | InChI=1S/C25H38N4O5/c1-8-10-11-16(19(31)22(33)26-12-9-2)28-21(32)18-17-15(25(17,6)7)13-29(18)23(34)20(27-14-30)24(3,4)5/h9,15-18,20H,2,8,10-13H2,1,3-7H3,(H,26,33)(H,28,32)/t15-,16?,17-,18-,20-/m0/s1 |
| InChIKey | XUXFZXLSZKXZAR-LEUZCIGGSA-N |
| XLogP | 1.77 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|