C12H20N2 — CID 143316770
3-methyl-N-(5-methylhex-1-en-2-yl)-2H-pyrrol-5-amine (PubChem CID 143316770) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 3-methyl-N-(5-methylhex-1-en-2-yl)-2H-pyrrol-5-amine.
| Compound Name | 3-methyl-N-(5-methylhex-1-en-2-yl)-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 143316770 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 3-methyl-N-(5-methylhex-1-en-2-yl)-2H-pyrrol-5-amine |
| SMILES | C=C(CCC(C)C)NC1=NCC(C)=C1 |
| InChI | InChI=1S/C12H20N2/c1-9(2)5-6-11(4)14-12-7-10(3)8-13-12/h7,9H,4-6,8H2,1-3H3,(H,13,14) |
| InChIKey | DQNKXHQCXGJTFI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |