C12H22N2 — CID 143316348
N-hex-1-en-2-yl-N',3-dimethylbut-2-enimidamide (PubChem CID 143316348) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is N-hex-1-en-2-yl-N',3-dimethylbut-2-enimidamide.
| Compound Name | N-hex-1-en-2-yl-N',3-dimethylbut-2-enimidamide |
|---|---|
| PubChem CID | 143316348 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | N-hex-1-en-2-yl-N',3-dimethylbut-2-enimidamide |
| SMILES | C=C(CCCC)N/C(C=C(C)C)=N/C |
| InChI | InChI=1S/C12H22N2/c1-6-7-8-11(4)14-12(13-5)9-10(2)3/h9H,4,6-8H2,1-3,5H3,(H,13,14) |
| InChIKey | YBDVFXJBPRRYEI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|