C11H11FO3 — CID 143320526
methyl 3-(5-fluorocyclohepta-1,4,6-trien-1-yl)-3-oxopropanoate (PubChem CID 143320526) has the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. Its IUPAC name is methyl 3-(5-fluorocyclohepta-1,4,6-trien-1-yl)-3-oxopropanoate.
| Compound Name | methyl 3-(5-fluorocyclohepta-1,4,6-trien-1-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 143320526 |
| Molecular Formula | C11H11FO3 |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | methyl 3-(5-fluorocyclohepta-1,4,6-trien-1-yl)-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)C1=CCC=C(F)C=C1 |
| InChI | InChI=1S/C11H11FO3/c1-15-11(14)7-10(13)8-3-2-4-9(12)6-5-8/h3-6H,2,7H2,1H3 |
| InChIKey | BJLBQIXFQDTVRW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|