C29H31NO4 — CID 143321707
2-[4-[3,3-dimethyl-5-(4-methylphenyl)-2H-indol-1-yl]-2-methylphenoxy]acetic acid;methoxyethyne (PubChem CID 143321707) has the molecular formula C29H31NO4 and a molecular weight of 457.57 g/mol. Its IUPAC name is 2-[4-[3,3-dimethyl-5-(4-methylphenyl)-2H-indol-1-yl]-2-methylphenoxy]acetic acid;methoxyethyne.
| Compound Name | 2-[4-[3,3-dimethyl-5-(4-methylphenyl)-2H-indol-1-yl]-2-methylphenoxy]acetic acid;methoxyethyne |
|---|---|
| PubChem CID | 143321707 |
| Molecular Formula | C29H31NO4 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 2-[4-[3,3-dimethyl-5-(4-methylphenyl)-2H-indol-1-yl]-2-methylphenoxy]acetic acid;methoxyethyne |
| SMILES | C#COC.Cc1ccc(-c2ccc3c(c2)C(C)(C)CN3c2ccc(OCC(=O)O)c(C)c2)cc1 |
| InChI | InChI=1S/C26H27NO3.C3H4O/c1-17-5-7-19(8-6-17)20-9-11-23-22(14-20)26(3,4)16-27(23)21-10-12-24(18(2)13-21)30-15-25(28)29;1-3-4-2/h5-14H,15-16H2,1-4H3,(H,28,29);1H,2H3 |
| InChIKey | MVXGQNCLCNXPGW-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|