C25H23BrO4 — CID 69006421
2-[4-[(E)-3-(4-bromophenyl)-3-(4-methylphenyl)prop-2-enoxy]-2-methylphenoxy]acetic acid (PubChem CID 69006421) has the molecular formula C25H23BrO4 and a molecular weight of 467.36 g/mol. Its IUPAC name is 2-[4-[(E)-3-(4-bromophenyl)-3-(4-methylphenyl)prop-2-enoxy]-2-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-3-(4-bromophenyl)-3-(4-methylphenyl)prop-2-enoxy]-2-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 69006421 |
| Molecular Formula | C25H23BrO4 |
| Molecular Weight | 467.36 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 2-[4-[(E)-3-(4-bromophenyl)-3-(4-methylphenyl)prop-2-enoxy]-2-methylphenoxy]acetic acid |
| SMILES | Cc1ccc(/C(=C\COc2ccc(OCC(=O)O)c(C)c2)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C25H23BrO4/c1-17-3-5-19(6-4-17)23(20-7-9-21(26)10-8-20)13-14-29-22-11-12-24(18(2)15-22)30-16-25(27)28/h3-13,15H,14,16H2,1-2H3,(H,27,28)/b23-13+ |
| InChIKey | VPIQSNNLQNTRIP-YDZHTSKRSA-N |
| XLogP | 6.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.36 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |