C39H29Br4ClO4 — CID 87464150
3-[4-[3,3-bis(4-bromophenyl)prop-2-enoxy]-2-methylphenoxy]-5,5-bis(4-bromophenyl)-3-chloropent-4-enoic acid (PubChem CID 87464150) has the molecular formula C39H29Br4ClO4 and a molecular weight of 916.73 g/mol. Its IUPAC name is 3-[4-[3,3-bis(4-bromophenyl)prop-2-enoxy]-2-methylphenoxy]-5,5-bis(4-bromophenyl)-3-chloropent-4-enoic acid.
| Compound Name | 3-[4-[3,3-bis(4-bromophenyl)prop-2-enoxy]-2-methylphenoxy]-5,5-bis(4-bromophenyl)-3-chloropent-4-enoic acid |
|---|---|
| PubChem CID | 87464150 |
| Molecular Formula | C39H29Br4ClO4 |
| Molecular Weight | 916.73 g/mol |
| Exact Mass | 911.85 |
| IUPAC Name | 3-[4-[3,3-bis(4-bromophenyl)prop-2-enoxy]-2-methylphenoxy]-5,5-bis(4-bromophenyl)-3-chloropent-4-enoic acid |
| SMILES | Cc1cc(OCC=C(c2ccc(Br)cc2)c2ccc(Br)cc2)ccc1OC(Cl)(C=C(c1ccc(Br)cc1)c1ccc(Br)cc1)CC(=O)O |
| InChI | InChI=1S/C39H29Br4ClO4/c1-25-22-34(47-21-20-35(26-2-10-30(40)11-3-26)27-4-12-31(41)13-5-27)18-19-37(25)48-39(44,24-38(45)46)23-36(28-6-14-32(42)15-7-28)29-8-16-33(43)17-9-29/h2-20,22-23H,21,24H2,1H3,(H,45,46) |
| InChIKey | WOHSAEINFYKDNB-UHFFFAOYSA-N |
| XLogP | 12.48 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.73 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|