C25H26BrNO5 — CID 59448148
2-[4-[(Z)-3-(4-bromophenyl)-6-morpholin-4-ylhex-2-en-4-ynoxy]-2-methylphenoxy]acetic acid (PubChem CID 59448148) has the molecular formula C25H26BrNO5 and a molecular weight of 500.39 g/mol. Its IUPAC name is 2-[4-[(Z)-3-(4-bromophenyl)-6-morpholin-4-ylhex-2-en-4-ynoxy]-2-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-3-(4-bromophenyl)-6-morpholin-4-ylhex-2-en-4-ynoxy]-2-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 59448148 |
| Molecular Formula | C25H26BrNO5 |
| Molecular Weight | 500.39 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | 2-[4-[(Z)-3-(4-bromophenyl)-6-morpholin-4-ylhex-2-en-4-ynoxy]-2-methylphenoxy]acetic acid |
| SMILES | Cc1cc(OC/C=C(\C#CCN2CCOCC2)c2ccc(Br)cc2)ccc1OCC(=O)O |
| InChI | InChI=1S/C25H26BrNO5/c1-19-17-23(8-9-24(19)32-18-25(28)29)31-14-10-20(21-4-6-22(26)7-5-21)3-2-11-27-12-15-30-16-13-27/h4-10,17H,11-16,18H2,1H3,(H,28,29)/b20-10+ |
| InChIKey | BZOQYMYKJZBTCL-KEBDBYFISA-N |
| XLogP | 4.02 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|