C32H33NO5 — CID 67146520
2-[2-methyl-4-[3-[4-(3-morpholin-4-ylprop-1-ynyl)phenyl]-3-phenylprop-2-enoxy]phenoxy]propanoic acid (PubChem CID 67146520) has the molecular formula C32H33NO5 and a molecular weight of 511.62 g/mol. Its IUPAC name is 2-[2-methyl-4-[3-[4-(3-morpholin-4-ylprop-1-ynyl)phenyl]-3-phenylprop-2-enoxy]phenoxy]propanoic acid.
| Compound Name | 2-[2-methyl-4-[3-[4-(3-morpholin-4-ylprop-1-ynyl)phenyl]-3-phenylprop-2-enoxy]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 67146520 |
| Molecular Formula | C32H33NO5 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 2-[2-methyl-4-[3-[4-(3-morpholin-4-ylprop-1-ynyl)phenyl]-3-phenylprop-2-enoxy]phenoxy]propanoic acid |
| SMILES | Cc1cc(OCC=C(c2ccccc2)c2ccc(C#CCN3CCOCC3)cc2)ccc1OC(C)C(=O)O |
| InChI | InChI=1S/C32H33NO5/c1-24-23-29(14-15-31(24)38-25(2)32(34)35)37-20-16-30(27-8-4-3-5-9-27)28-12-10-26(11-13-28)7-6-17-33-18-21-36-22-19-33/h3-5,8-16,23,25H,17-22H2,1-2H3,(H,34,35) |
| InChIKey | REAOYSDHRGPNEV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|