C26H33N3O4 — CID 143321778
tert-butyl N-[[(3R)-5-(9H-xanthen-9-ylmethylcarbamoyl)piperidin-3-yl]methyl]carbamate (PubChem CID 143321778) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is tert-butyl N-[[(3R)-5-(9H-xanthen-9-ylmethylcarbamoyl)piperidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(3R)-5-(9H-xanthen-9-ylmethylcarbamoyl)piperidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 143321778 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | tert-butyl N-[[(3R)-5-(9H-xanthen-9-ylmethylcarbamoyl)piperidin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1CNCC(C(=O)NCC2c3ccccc3Oc3ccccc32)C1 |
| InChI | InChI=1S/C26H33N3O4/c1-26(2,3)33-25(31)29-14-17-12-18(15-27-13-17)24(30)28-16-21-19-8-4-6-10-22(19)32-23-11-7-5-9-20(21)23/h4-11,17-18,21,27H,12-16H2,1-3H3,(H,28,30)(H,29,31)/t17-,18?/m1/s1 |
| InChIKey | RBELYSUKJKOSSL-QNSVNVJESA-N |
| XLogP | 3.79 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |