C27H33N3O5 — CID 69136579
tert-butyl 3-(methylcarbamoyl)-5-(9H-xanthen-9-ylmethylcarbamoyl)piperidine-1-carboxylate (PubChem CID 69136579) has the molecular formula C27H33N3O5 and a molecular weight of 479.58 g/mol. Its IUPAC name is tert-butyl 3-(methylcarbamoyl)-5-(9H-xanthen-9-ylmethylcarbamoyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(methylcarbamoyl)-5-(9H-xanthen-9-ylmethylcarbamoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 69136579 |
| Molecular Formula | C27H33N3O5 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | tert-butyl 3-(methylcarbamoyl)-5-(9H-xanthen-9-ylmethylcarbamoyl)piperidine-1-carboxylate |
| SMILES | CNC(=O)C1CC(C(=O)NCC2c3ccccc3Oc3ccccc32)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C27H33N3O5/c1-27(2,3)35-26(33)30-15-17(24(31)28-4)13-18(16-30)25(32)29-14-21-19-9-5-7-11-22(19)34-23-12-8-6-10-20(21)23/h5-12,17-18,21H,13-16H2,1-4H3,(H,28,31)(H,29,32) |
| InChIKey | SJBJEZOGAMJJRK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |