C31H28ClN7O4S — CID 143323582
7-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-3-[hydroxy-[4-(morpholin-4-ylmethyl)anilino]methyl]-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one (PubChem CID 143323582) has the molecular formula C31H28ClN7O4S and a molecular weight of 630.13 g/mol. Its IUPAC name is 7-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-3-[hydroxy-[4-(morpholin-4-ylmethyl)anilino]methyl]-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one.
| Compound Name | 7-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-3-[hydroxy-[4-(morpholin-4-ylmethyl)anilino]methyl]-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one |
|---|---|
| PubChem CID | 143323582 |
| Molecular Formula | C31H28ClN7O4S |
| Molecular Weight | 630.13 g/mol |
| Exact Mass | 629.16 |
| IUPAC Name | 7-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-3-[hydroxy-[4-(morpholin-4-ylmethyl)anilino]methyl]-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one |
| SMILES | O=C1Nc2c(C(O)Nc3ccc(CN4CCOCC4)cc3)sc3ncnc(c23)N1c1ccc(OCc2ccccn2)c(Cl)c1 |
| InChI | InChI=1S/C31H28ClN7O4S/c32-23-15-22(8-9-24(23)43-17-21-3-1-2-10-33-21)39-28-25-26(37-31(39)41)27(44-30(25)35-18-34-28)29(40)36-20-6-4-19(5-7-20)16-38-11-13-42-14-12-38/h1-10,15,18,29,36,40H,11-14,16-17H2,(H,37,41) |
| InChIKey | UHFCRHZWWYBGBN-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 124.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.13 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|