C33H31IN8O3S — CID 89322316
7-[3-(iodomethyl)-4-(pyridin-2-ylmethoxy)phenyl]-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-6-oxo-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 89322316) has the molecular formula C33H31IN8O3S and a molecular weight of 746.63 g/mol. Its IUPAC name is 7-[3-(iodomethyl)-4-(pyridin-2-ylmethoxy)phenyl]-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-6-oxo-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-[3-(iodomethyl)-4-(pyridin-2-ylmethoxy)phenyl]-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-6-oxo-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 89322316 |
| Molecular Formula | C33H31IN8O3S |
| Molecular Weight | 746.63 g/mol |
| Exact Mass | 746.13 |
| IUPAC Name | 7-[3-(iodomethyl)-4-(pyridin-2-ylmethoxy)phenyl]-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-6-oxo-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | CN1CCN(Cc2ccc(NC(=O)c3sc4ncnc5c4c3NC(=O)N5c3ccc(OCc4ccccn4)c(CI)c3)cc2)CC1 |
| InChI | InChI=1S/C33H31IN8O3S/c1-40-12-14-41(15-13-40)18-21-5-7-23(8-6-21)38-31(43)29-28-27-30(36-20-37-32(27)46-29)42(33(44)39-28)25-9-10-26(22(16-25)17-34)45-19-24-4-2-3-11-35-24/h2-11,16,20H,12-15,17-19H2,1H3,(H,38,43)(H,39,44) |
| InChIKey | BLLMTZPJZDBLRS-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.63 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|