C30H31IN6O5S — CID 89322352
7-[2-(iodomethyl)-3,4,5-trimethoxyphenyl]-6-oxo-N-[4-(piperidin-1-ylmethyl)phenyl]-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 89322352) has the molecular formula C30H31IN6O5S and a molecular weight of 714.59 g/mol. Its IUPAC name is 7-[2-(iodomethyl)-3,4,5-trimethoxyphenyl]-6-oxo-N-[4-(piperidin-1-ylmethyl)phenyl]-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-[2-(iodomethyl)-3,4,5-trimethoxyphenyl]-6-oxo-N-[4-(piperidin-1-ylmethyl)phenyl]-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 89322352 |
| Molecular Formula | C30H31IN6O5S |
| Molecular Weight | 714.59 g/mol |
| Exact Mass | 714.11 |
| IUPAC Name | 7-[2-(iodomethyl)-3,4,5-trimethoxyphenyl]-6-oxo-N-[4-(piperidin-1-ylmethyl)phenyl]-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | COc1cc(N2C(=O)Nc3c(C(=O)Nc4ccc(CN5CCCCC5)cc4)sc4ncnc2c34)c(CI)c(OC)c1OC |
| InChI | InChI=1S/C30H31IN6O5S/c1-40-21-13-20(19(14-31)24(41-2)25(21)42-3)37-27-22-23(35-30(37)39)26(43-29(22)33-16-32-27)28(38)34-18-9-7-17(8-10-18)15-36-11-5-4-6-12-36/h7-10,13,16H,4-6,11-12,14-15H2,1-3H3,(H,34,38)(H,35,39) |
| InChIKey | OGNVHPKAZOMNCK-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.59 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|