C24H20FIN6O2S — CID 89322358
N-[4-[(dimethylamino)methyl]phenyl]-7-[4-fluoro-3-(iodomethyl)phenyl]-6-oxo-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 89322358) has the molecular formula C24H20FIN6O2S and a molecular weight of 602.43 g/mol. Its IUPAC name is N-[4-[(dimethylamino)methyl]phenyl]-7-[4-fluoro-3-(iodomethyl)phenyl]-6-oxo-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | N-[4-[(dimethylamino)methyl]phenyl]-7-[4-fluoro-3-(iodomethyl)phenyl]-6-oxo-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 89322358 |
| Molecular Formula | C24H20FIN6O2S |
| Molecular Weight | 602.43 g/mol |
| Exact Mass | 602.04 |
| IUPAC Name | N-[4-[(dimethylamino)methyl]phenyl]-7-[4-fluoro-3-(iodomethyl)phenyl]-6-oxo-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | CN(C)Cc1ccc(NC(=O)c2sc3ncnc4c3c2NC(=O)N4c2ccc(F)c(CI)c2)cc1 |
| InChI | InChI=1S/C24H20FIN6O2S/c1-31(2)11-13-3-5-15(6-4-13)29-22(33)20-19-18-21(27-12-28-23(18)35-20)32(24(34)30-19)16-7-8-17(25)14(9-16)10-26/h3-9,12H,10-11H2,1-2H3,(H,29,33)(H,30,34) |
| InChIKey | SKUFDTAMLMOGNC-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.43 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|