C20H21N7OS — CID 91229231
N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,6,8(12),9-pentaene-3-carboxamide (PubChem CID 91229231) has the molecular formula C20H21N7OS and a molecular weight of 407.50 g/mol. Its IUPAC name is N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,6,8(12),9-pentaene-3-carboxamide.
| Compound Name | N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,6,8(12),9-pentaene-3-carboxamide |
|---|---|
| PubChem CID | 91229231 |
| Molecular Formula | C20H21N7OS |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,6,8(12),9-pentaene-3-carboxamide |
| SMILES | CN1CCN(Cc2ccc(NC(=O)c3sc4ncnc5c4c3NC=N5)cc2)CC1 |
| InChI | InChI=1S/C20H21N7OS/c1-26-6-8-27(9-7-26)10-13-2-4-14(5-3-13)25-19(28)17-16-15-18(22-11-21-16)23-12-24-20(15)29-17/h2-5,11-12H,6-10H2,1H3,(H,25,28)(H,21,22,23,24) |
| InChIKey | HLDJXQGQBNFWPD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |