C25H37NO2S3 — CID 143324523
[5-(cyclohexen-1-yl)-3-[methyl-(1-oxothian-4-yl)amino]thiophen-2-yl]-[(4-methylcyclohexyl)methylidene-λ4-sulfanylidene]methanol (PubChem CID 143324523) has the molecular formula C25H37NO2S3 and a molecular weight of 479.78 g/mol. Its IUPAC name is [5-(cyclohexen-1-yl)-3-[methyl-(1-oxothian-4-yl)amino]thiophen-2-yl]-[(4-methylcyclohexyl)methylidene-λ4-sulfanylidene]methanol.
| Compound Name | [5-(cyclohexen-1-yl)-3-[methyl-(1-oxothian-4-yl)amino]thiophen-2-yl]-[(4-methylcyclohexyl)methylidene-λ4-sulfanylidene]methanol |
|---|---|
| PubChem CID | 143324523 |
| Molecular Formula | C25H37NO2S3 |
| Molecular Weight | 479.78 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | [5-(cyclohexen-1-yl)-3-[methyl-(1-oxothian-4-yl)amino]thiophen-2-yl]-[(4-methylcyclohexyl)methylidene-λ4-sulfanylidene]methanol |
| SMILES | CC1CCC(C=S=C(O)c2sc(C3=CCCCC3)cc2N(C)C2CCS(=O)CC2)CC1 |
| InChI | InChI=1S/C25H37NO2S3/c1-18-8-10-19(11-9-18)17-29-25(27)24-22(26(2)21-12-14-31(28)15-13-21)16-23(30-24)20-6-4-3-5-7-20/h6,16-19,21,27H,3-5,7-15H2,1-2H3 |
| InChIKey | DGHQYPVHIHJUAI-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.78 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|