C20H25NO4S — CID 67475677
5-(cyclohexen-1-yl)-3-[(4-oxocyclohexyl)-propanoylamino]thiophene-2-carboxylic acid (PubChem CID 67475677) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is 5-(cyclohexen-1-yl)-3-[(4-oxocyclohexyl)-propanoylamino]thiophene-2-carboxylic acid.
| Compound Name | 5-(cyclohexen-1-yl)-3-[(4-oxocyclohexyl)-propanoylamino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 67475677 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 5-(cyclohexen-1-yl)-3-[(4-oxocyclohexyl)-propanoylamino]thiophene-2-carboxylic acid |
| SMILES | CCC(=O)N(c1cc(C2=CCCCC2)sc1C(=O)O)C1CCC(=O)CC1 |
| InChI | InChI=1S/C20H25NO4S/c1-2-18(23)21(14-8-10-15(22)11-9-14)16-12-17(26-19(16)20(24)25)13-6-4-3-5-7-13/h6,12,14H,2-5,7-11H2,1H3,(H,24,25) |
| InChIKey | CLGPYBPOLUVOJX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |