C19H21NO3S2 — CID 71057513
5-phenyl-3-[propanoyl(thian-4-yl)amino]thiophene-2-carboxylic acid (PubChem CID 71057513) has the molecular formula C19H21NO3S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is 5-phenyl-3-[propanoyl(thian-4-yl)amino]thiophene-2-carboxylic acid.
| Compound Name | 5-phenyl-3-[propanoyl(thian-4-yl)amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 71057513 |
| Molecular Formula | C19H21NO3S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 5-phenyl-3-[propanoyl(thian-4-yl)amino]thiophene-2-carboxylic acid |
| SMILES | CCC(=O)N(c1cc(-c2ccccc2)sc1C(=O)O)C1CCSCC1 |
| InChI | InChI=1S/C19H21NO3S2/c1-2-17(21)20(14-8-10-24-11-9-14)15-12-16(25-18(15)19(22)23)13-6-4-3-5-7-13/h3-7,12,14H,2,8-11H2,1H3,(H,22,23) |
| InChIKey | IHIGXMPDRFCTHU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |