C24H30N2O3S+ — CID 59752348
CID 59752348 (PubChem CID 59752348) has the molecular formula C24H30N2O3S+ and a molecular weight of 426.58 g/mol.
| Compound Name | CID 59752348 |
|---|---|
| PubChem CID | 59752348 |
| Molecular Formula | C24H30N2O3S+ |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | — |
| SMILES | CC1CCC(C(=O)N(c2cc(-c3ccccc3)sc2C(=O)O)C2CC[NH+]CC2)CC1 |
| InChI | InChI=1S/C24H30N2O3S/c1-16-7-9-18(10-8-16)23(27)26(19-11-13-25-14-12-19)20-15-21(30-22(20)24(28)29)17-5-3-2-4-6-17/h2-6,15-16,18-19,25H,7-14H2,1H3,(H,28,29)/q+1 |
| InChIKey | VSQOYOIMIBMWIE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |