About CID 59752348
CID 59752348 (PubChem CID 59752348) has the molecular formula C24H30N2O3S+
and a molecular weight of 426.58 g/mol.
Molecular Properties
| Compound Name | CID 59752348 |
| PubChem CID | 59752348 |
| Molecular Formula | C24H30N2O3S+ |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | — |
| SMILES | CC1CCC(C(=O)N(c2cc(-c3ccccc3)sc2C(=O)O)C2CC[NH+]CC2)CC1 |
| InChI | InChI=1S/C24H30N2O3S/c1-16-7-9-18(10-8-16)23(27)26(19-11-13-25-14-12-19)20-15-21(30-22(20)24(28)29)17-5-3-2-4-6-17/h2-6,15-16,18-19,25H,7-14H2,1H3,(H,28,29)/q+1 |
| InChIKey | VSQOYOIMIBMWIE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 59752348 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59752348?
The IUPAC name of CID 59752348 (CID 59752348) is not available.
What is the SMILES notation for CID 59752348?
The canonical SMILES for CID 59752348 is CC1CCC(C(=O)N(c2cc(-c3ccccc3)sc2C(=O)O)C2CC[NH+]CC2)CC1.
What is the InChIKey of CID 59752348?
The InChIKey is VSQOYOIMIBMWIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N2O3S/c1-16-7-9-18(10-8-16)23(27)26(19-11-13-25-14-12-19)20-15-21(30-22(20)24(28)29)17-5-3-2-4-6-17/h2-6,15-16,18-19,25H,7-14H2,1H3,(H,28,29)/q+1.
What are the key properties of CID 59752348?
CID 59752348 has a molecular weight of 426.58 g/mol, XLogP of 3.78, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59752348 is sourced from PubChem (CID 59752348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).