C25H32N2O3S+ — CID 58664441
CID 58664441 (PubChem CID 58664441) has the molecular formula C25H32N2O3S+ and a molecular weight of 440.61 g/mol.
| Compound Name | CID 58664441 |
|---|---|
| PubChem CID | 58664441 |
| Molecular Formula | C25H32N2O3S+ |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | — |
| SMILES | CC1CCC(C(=O)N(CC2CC[NH+]CC2)c2cc(-c3ccccc3)sc2C(=O)O)CC1 |
| InChI | InChI=1S/C25H32N2O3S/c1-17-7-9-20(10-8-17)24(28)27(16-18-11-13-26-14-12-18)21-15-22(31-23(21)25(29)30)19-5-3-2-4-6-19/h2-6,15,17-18,20,26H,7-14,16H2,1H3,(H,29,30)/q+1 |
| InChIKey | QQBGZHSLVLGTBE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |