C44H42N4O4S — CID 69009891
3-[ethyl-(4-methylcyclohexanecarbonyl)amino]-5-[4-[(1-tritylpyrazole-3-carbonyl)amino]phenyl]thiophene-2-carboxylic acid (PubChem CID 69009891) has the molecular formula C44H42N4O4S and a molecular weight of 722.91 g/mol. Its IUPAC name is 3-[ethyl-(4-methylcyclohexanecarbonyl)amino]-5-[4-[(1-tritylpyrazole-3-carbonyl)amino]phenyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[ethyl-(4-methylcyclohexanecarbonyl)amino]-5-[4-[(1-tritylpyrazole-3-carbonyl)amino]phenyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 69009891 |
| Molecular Formula | C44H42N4O4S |
| Molecular Weight | 722.91 g/mol |
| Exact Mass | 722.29 |
| IUPAC Name | 3-[ethyl-(4-methylcyclohexanecarbonyl)amino]-5-[4-[(1-tritylpyrazole-3-carbonyl)amino]phenyl]thiophene-2-carboxylic acid |
| SMILES | CCN(C(=O)C1CCC(C)CC1)c1cc(-c2ccc(NC(=O)c3ccn(C(c4ccccc4)(c4ccccc4)c4ccccc4)n3)cc2)sc1C(=O)O |
| InChI | InChI=1S/C44H42N4O4S/c1-3-47(42(50)32-21-19-30(2)20-22-32)38-29-39(53-40(38)43(51)52)31-23-25-36(26-24-31)45-41(49)37-27-28-48(46-37)44(33-13-7-4-8-14-33,34-15-9-5-10-16-34)35-17-11-6-12-18-35/h4-18,23-30,32H,3,19-22H2,1-2H3,(H,45,49)(H,51,52) |
| InChIKey | VCMDYROYGAXGKV-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.91 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|