C21H30N2O3S — CID 70989006
methyl 3-[(4-aminocyclohexyl)-propanoylamino]-5-(cyclohexen-1-yl)thiophene-2-carboxylate (PubChem CID 70989006) has the molecular formula C21H30N2O3S and a molecular weight of 390.55 g/mol. Its IUPAC name is methyl 3-[(4-aminocyclohexyl)-propanoylamino]-5-(cyclohexen-1-yl)thiophene-2-carboxylate.
| Compound Name | methyl 3-[(4-aminocyclohexyl)-propanoylamino]-5-(cyclohexen-1-yl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 70989006 |
| Molecular Formula | C21H30N2O3S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | methyl 3-[(4-aminocyclohexyl)-propanoylamino]-5-(cyclohexen-1-yl)thiophene-2-carboxylate |
| SMILES | CCC(=O)N(c1cc(C2=CCCCC2)sc1C(=O)OC)C1CCC(N)CC1 |
| InChI | InChI=1S/C21H30N2O3S/c1-3-19(24)23(16-11-9-15(22)10-12-16)17-13-18(14-7-5-4-6-8-14)27-20(17)21(25)26-2/h7,13,15-16H,3-6,8-12,22H2,1-2H3 |
| InChIKey | PZHHWFOAHSKWKZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |