C12H19N3 — CID 143325148
3-(2,3-dihydrobenzimidazol-1-yl)-N-methylbutan-1-amine (PubChem CID 143325148) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is 3-(2,3-dihydrobenzimidazol-1-yl)-N-methylbutan-1-amine.
| Compound Name | 3-(2,3-dihydrobenzimidazol-1-yl)-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 143325148 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 3-(2,3-dihydrobenzimidazol-1-yl)-N-methylbutan-1-amine |
| SMILES | CNCCC(C)N1CNc2ccccc21 |
| InChI | InChI=1S/C12H19N3/c1-10(7-8-13-2)15-9-14-11-5-3-4-6-12(11)15/h3-6,10,13-14H,7-9H2,1-2H3 |
| InChIKey | DRGIGTUNKRKADT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |