C10H17N3 — CID 143325176
(Z,Z)-N-(1-piperazin-1-ylethenyl)but-2-en-1-imine (PubChem CID 143325176) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is (Z,Z)-N-(1-piperazin-1-ylethenyl)but-2-en-1-imine.
| Compound Name | (Z,Z)-N-(1-piperazin-1-ylethenyl)but-2-en-1-imine |
|---|---|
| PubChem CID | 143325176 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | (Z,Z)-N-(1-piperazin-1-ylethenyl)but-2-en-1-imine |
| SMILES | C=C(/N=C\C=C/C)N1CCNCC1 |
| InChI | InChI=1S/C10H17N3/c1-3-4-5-12-10(2)13-8-6-11-7-9-13/h3-5,11H,2,6-9H2,1H3/b4-3-,12-5- |
| InChIKey | ZPKRNDMUORBZGB-HVSXSXIDSA-N |
| XLogP | 1.01 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|