C17H26OPd — CID 143325802
5-ethyl-6-methoxybicyclo[2.2.1]hept-2-ene;palladium;1-propylcyclobuta-1,2-diene (PubChem CID 143325802) has the molecular formula C17H26OPd and a molecular weight of 352.81 g/mol. Its IUPAC name is 5-ethyl-6-methoxybicyclo[2.2.1]hept-2-ene;palladium;1-propylcyclobuta-1,2-diene.
| Compound Name | 5-ethyl-6-methoxybicyclo[2.2.1]hept-2-ene;palladium;1-propylcyclobuta-1,2-diene |
|---|---|
| PubChem CID | 143325802 |
| Molecular Formula | C17H26OPd |
| Molecular Weight | 352.81 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 5-ethyl-6-methoxybicyclo[2.2.1]hept-2-ene;palladium;1-propylcyclobuta-1,2-diene |
| SMILES | CCC1C2C=CC(C2)C1OC.CCCC1=C=CC1.[Pd] |
| InChI | InChI=1S/C10H16O.C7H10.Pd/c1-3-9-7-4-5-8(6-7)10(9)11-2;1-2-4-7-5-3-6-7;/h4-5,7-10H,3,6H2,1-2H3;3H,2,4-5H2,1H3; |
| InChIKey | QMUYEYYVVRJPRM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.81 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|