C20H38O3S2Si — CID 20650000
trimethoxy-[3-[2-[3-(2-propylsulfanylethyl)-2-bicyclo[2.2.1]hept-5-enyl]ethylsulfanyl]propyl]silane (PubChem CID 20650000) has the molecular formula C20H38O3S2Si and a molecular weight of 418.74 g/mol. Its IUPAC name is trimethoxy-[3-[2-[3-(2-propylsulfanylethyl)-2-bicyclo[2.2.1]hept-5-enyl]ethylsulfanyl]propyl]silane.
| Compound Name | trimethoxy-[3-[2-[3-(2-propylsulfanylethyl)-2-bicyclo[2.2.1]hept-5-enyl]ethylsulfanyl]propyl]silane |
|---|---|
| PubChem CID | 20650000 |
| Molecular Formula | C20H38O3S2Si |
| Molecular Weight | 418.74 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | trimethoxy-[3-[2-[3-(2-propylsulfanylethyl)-2-bicyclo[2.2.1]hept-5-enyl]ethylsulfanyl]propyl]silane |
| SMILES | CCCSCCC1C2C=CC(C2)C1CCSCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C20H38O3S2Si/c1-5-11-24-13-9-19-17-7-8-18(16-17)20(19)10-14-25-12-6-15-26(21-2,22-3)23-4/h7-8,17-20H,5-6,9-16H2,1-4H3 |
| InChIKey | PRAWVBDPKCSQNT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.74 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|