C19H36N4O5Si — CID 20649877
1-butyl-3-[3-(3-trimethoxysilylpropylcarbamoylamino)-2-bicyclo[2.2.1]hept-5-enyl]urea (PubChem CID 20649877) has the molecular formula C19H36N4O5Si and a molecular weight of 428.61 g/mol. Its IUPAC name is 1-butyl-3-[3-(3-trimethoxysilylpropylcarbamoylamino)-2-bicyclo[2.2.1]hept-5-enyl]urea.
| Compound Name | 1-butyl-3-[3-(3-trimethoxysilylpropylcarbamoylamino)-2-bicyclo[2.2.1]hept-5-enyl]urea |
|---|---|
| PubChem CID | 20649877 |
| Molecular Formula | C19H36N4O5Si |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 1-butyl-3-[3-(3-trimethoxysilylpropylcarbamoylamino)-2-bicyclo[2.2.1]hept-5-enyl]urea |
| SMILES | CCCCNC(=O)NC1C2C=CC(C2)C1NC(=O)NCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C19H36N4O5Si/c1-5-6-10-20-18(24)22-16-14-8-9-15(13-14)17(16)23-19(25)21-11-7-12-29(26-2,27-3)28-4/h8-9,14-17H,5-7,10-13H2,1-4H3,(H2,20,22,24)(H2,21,23,25) |
| InChIKey | NXVRUDRXABBUOM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 109.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|