C18H31NO6Si — CID 174032142
(1S,4R)-3-(3-triethoxysilylpropylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 174032142) has the molecular formula C18H31NO6Si and a molecular weight of 385.53 g/mol. Its IUPAC name is (1S,4R)-3-(3-triethoxysilylpropylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,4R)-3-(3-triethoxysilylpropylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 174032142 |
| Molecular Formula | C18H31NO6Si |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | (1S,4R)-3-(3-triethoxysilylpropylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CCO[Si](CCCNC(=O)C1C(C(=O)O)[C@@H]2C=C[C@H]1C2)(OCC)OCC |
| InChI | InChI=1S/C18H31NO6Si/c1-4-23-26(24-5-2,25-6-3)11-7-10-19-17(20)15-13-8-9-14(12-13)16(15)18(21)22/h8-9,13-16H,4-7,10-12H2,1-3H3,(H,19,20)(H,21,22)/t13-,14+,15?,16?/m0/s1 |
| InChIKey | LLHZTXMWJLKSDH-QRNKSROTSA-N |
| XLogP | 2.06 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|