C15H25NO5Si — CID 166567621
3-[3-[dimethoxy(methyl)silyl]propylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 166567621) has the molecular formula C15H25NO5Si and a molecular weight of 327.45 g/mol. Its IUPAC name is 3-[3-[dimethoxy(methyl)silyl]propylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 3-[3-[dimethoxy(methyl)silyl]propylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 166567621 |
| Molecular Formula | C15H25NO5Si |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 3-[3-[dimethoxy(methyl)silyl]propylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CO[Si](C)(CCCNC(=O)C1C2C=CC(C2)C1C(=O)O)OC |
| InChI | InChI=1S/C15H25NO5Si/c1-20-22(3,21-2)8-4-7-16-14(17)12-10-5-6-11(9-10)13(12)15(18)19/h5-6,10-13H,4,7-9H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | WDAGPFJRCGUPBY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|