About butyl(trimethoxy)silane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione
butyl(trimethoxy)silane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 90943066) has the molecular formula C17H28O5Si
and a molecular weight of 340.49 g/mol. Its IUPAC name is butyl(trimethoxy)silane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
Molecular Properties
| Compound Name | butyl(trimethoxy)silane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| PubChem CID | 90943066 |
| Molecular Formula | C17H28O5Si |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | butyl(trimethoxy)silane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CCCC[Si](OC)(OC)OC.O=C1CC(=O)C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C10H10O2.C7H18O3Si/c11-7-4-8(12)10-6-2-1-5(3-6)9(7)10;1-5-6-7-11(8-2,9-3)10-4/h1-2,5-6,9-10H,3-4H2;5-7H2,1-4H3 |
| InChIKey | SFLGHUQHICUSJZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butyl(trimethoxy)silane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(trimethoxy)silane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione?
The IUPAC name of butyl(trimethoxy)silane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (CID 90943066) is butyl(trimethoxy)silane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
What is the SMILES notation for butyl(trimethoxy)silane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione?
The canonical SMILES for butyl(trimethoxy)silane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione is CCCC[Si](OC)(OC)OC.O=C1CC(=O)C2C3C=CC(C3)C12.
What is the InChIKey of butyl(trimethoxy)silane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione?
The InChIKey is SFLGHUQHICUSJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2.C7H18O3Si/c11-7-4-8(12)10-6-2-1-5(3-6)9(7)10;1-5-6-7-11(8-2,9-3)10-4/h1-2,5-6,9-10H,3-4H2;5-7H2,1-4H3.
What are the key properties of butyl(trimethoxy)silane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione?
butyl(trimethoxy)silane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione has a molecular weight of 340.49 g/mol, XLogP of 2.63, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(trimethoxy)silane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione is sourced from PubChem (CID 90943066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).