C8H16N2OS — CID 143328329
ethane;2-sulfanylidene-1,3-dihydroimidazole-4-carbaldehyde (PubChem CID 143328329) has the molecular formula C8H16N2OS and a molecular weight of 188.30 g/mol. Its IUPAC name is ethane;2-sulfanylidene-1,3-dihydroimidazole-4-carbaldehyde.
| Compound Name | ethane;2-sulfanylidene-1,3-dihydroimidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 143328329 |
| Molecular Formula | C8H16N2OS |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | ethane;2-sulfanylidene-1,3-dihydroimidazole-4-carbaldehyde |
| SMILES | CC.CC.O=Cc1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C4H4N2OS.2C2H6/c7-2-3-1-5-4(8)6-3;2*1-2/h1-2H,(H2,5,6,8);2*1-2H3 |
| InChIKey | NGGNNIBXTKKEQT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|