C11H23N3S — CID 143328727
2,3-dimethyl-4-piperidin-3-yl-2H-1,3-thiazole;methanamine (PubChem CID 143328727) has the molecular formula C11H23N3S and a molecular weight of 229.39 g/mol. Its IUPAC name is 2,3-dimethyl-4-piperidin-3-yl-2H-1,3-thiazole;methanamine.
| Compound Name | 2,3-dimethyl-4-piperidin-3-yl-2H-1,3-thiazole;methanamine |
|---|---|
| PubChem CID | 143328727 |
| Molecular Formula | C11H23N3S |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 2,3-dimethyl-4-piperidin-3-yl-2H-1,3-thiazole;methanamine |
| SMILES | CC1SC=C(C2CCCNC2)N1C.CN |
| InChI | InChI=1S/C10H18N2S.CH5N/c1-8-12(2)10(7-13-8)9-4-3-5-11-6-9;1-2/h7-9,11H,3-6H2,1-2H3;2H2,1H3 |
| InChIKey | GBNHLDJSLFUUSH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |