About 5,9-diethoxy-7-[4-(sulfanylmethyl)phenyl]-6H-pyrrolo[3,4-g]quinolin-8-one
5,9-diethoxy-7-[4-(sulfanylmethyl)phenyl]-6H-pyrrolo[3,4-g]quinolin-8-one (PubChem CID 143330059) has the molecular formula C22H22N2O3S
and a molecular weight of 394.50 g/mol. Its IUPAC name is 5,9-diethoxy-7-[4-(sulfanylmethyl)phenyl]-6H-pyrrolo[3,4-g]quinolin-8-one.
Molecular Properties
| Compound Name | 5,9-diethoxy-7-[4-(sulfanylmethyl)phenyl]-6H-pyrrolo[3,4-g]quinolin-8-one |
| PubChem CID | 143330059 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 5,9-diethoxy-7-[4-(sulfanylmethyl)phenyl]-6H-pyrrolo[3,4-g]quinolin-8-one |
| SMILES | CCOc1c2c(c(OCC)c3ncccc13)C(=O)N(c1ccc(CS)cc1)C2 |
| InChI | InChI=1S/C22H22N2O3S/c1-3-26-20-16-6-5-11-23-19(16)21(27-4-2)18-17(20)12-24(22(18)25)15-9-7-14(13-28)8-10-15/h5-11,28H,3-4,12-13H2,1-2H3 |
| InChIKey | QEEDHUDMPKSIQK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 51.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5,9-diethoxy-7-[4-(sulfanylmethyl)phenyl]-6H-pyrrolo[3,4-g]quinolin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,9-diethoxy-7-[4-(sulfanylmethyl)phenyl]-6H-pyrrolo[3,4-g]quinolin-8-one?
The IUPAC name of 5,9-diethoxy-7-[4-(sulfanylmethyl)phenyl]-6H-pyrrolo[3,4-g]quinolin-8-one (CID 143330059) is 5,9-diethoxy-7-[4-(sulfanylmethyl)phenyl]-6H-pyrrolo[3,4-g]quinolin-8-one.
What is the SMILES notation for 5,9-diethoxy-7-[4-(sulfanylmethyl)phenyl]-6H-pyrrolo[3,4-g]quinolin-8-one?
The canonical SMILES for 5,9-diethoxy-7-[4-(sulfanylmethyl)phenyl]-6H-pyrrolo[3,4-g]quinolin-8-one is CCOc1c2c(c(OCC)c3ncccc13)C(=O)N(c1ccc(CS)cc1)C2.
What is the InChIKey of 5,9-diethoxy-7-[4-(sulfanylmethyl)phenyl]-6H-pyrrolo[3,4-g]quinolin-8-one?
The InChIKey is QEEDHUDMPKSIQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O3S/c1-3-26-20-16-6-5-11-23-19(16)21(27-4-2)18-17(20)12-24(22(18)25)15-9-7-14(13-28)8-10-15/h5-11,28H,3-4,12-13H2,1-2H3.
What are the key properties of 5,9-diethoxy-7-[4-(sulfanylmethyl)phenyl]-6H-pyrrolo[3,4-g]quinolin-8-one?
5,9-diethoxy-7-[4-(sulfanylmethyl)phenyl]-6H-pyrrolo[3,4-g]quinolin-8-one has a molecular weight of 394.50 g/mol, XLogP of 4.62, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,9-diethoxy-7-[4-(sulfanylmethyl)phenyl]-6H-pyrrolo[3,4-g]quinolin-8-one is sourced from PubChem (CID 143330059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).