C12H13ClN2O3 — CID 14333139
3-[(5-hydroxy-2-methoxyphenyl)methyl]-1H-pyridazin-6-one;hydrochloride (PubChem CID 14333139) has the molecular formula C12H13ClN2O3 and a molecular weight of 268.70 g/mol. Its IUPAC name is 3-[(5-hydroxy-2-methoxyphenyl)methyl]-1H-pyridazin-6-one;hydrochloride.
| Compound Name | 3-[(5-hydroxy-2-methoxyphenyl)methyl]-1H-pyridazin-6-one;hydrochloride |
|---|---|
| PubChem CID | 14333139 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 3-[(5-hydroxy-2-methoxyphenyl)methyl]-1H-pyridazin-6-one;hydrochloride |
| SMILES | COc1ccc(O)cc1Cc1ccc(=O)[nH]n1.Cl |
| InChI | InChI=1S/C12H12N2O3.ClH/c1-17-11-4-3-10(15)7-8(11)6-9-2-5-12(16)14-13-9;/h2-5,7,15H,6H2,1H3,(H,14,16);1H |
| InChIKey | ANNMJJPNGNKCCY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |