C8H11N — CID 143332140
6-prop-1-en-2-yl-2,3-dihydropyridine (PubChem CID 143332140) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is 6-prop-1-en-2-yl-2,3-dihydropyridine.
| Compound Name | 6-prop-1-en-2-yl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 143332140 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 6-prop-1-en-2-yl-2,3-dihydropyridine |
| SMILES | C=C(C)C1=NCCC=C1 |
| InChI | InChI=1S/C8H11N/c1-7(2)8-5-3-4-6-9-8/h3,5H,1,4,6H2,2H3 |
| InChIKey | RUTLVCTXKRCZFV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |