C18H30N2O3 — CID 143332314
6-[(4Z,6Z)-7-butoxy-6-methoxy-3-methylideneocta-4,6-dienyl]piperazin-2-one (PubChem CID 143332314) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is 6-[(4Z,6Z)-7-butoxy-6-methoxy-3-methylideneocta-4,6-dienyl]piperazin-2-one.
| Compound Name | 6-[(4Z,6Z)-7-butoxy-6-methoxy-3-methylideneocta-4,6-dienyl]piperazin-2-one |
|---|---|
| PubChem CID | 143332314 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 6-[(4Z,6Z)-7-butoxy-6-methoxy-3-methylideneocta-4,6-dienyl]piperazin-2-one |
| SMILES | C=C(/C=C\C(OC)=C(/C)OCCCC)CCC1CNCC(=O)N1 |
| InChI | InChI=1S/C18H30N2O3/c1-5-6-11-23-15(3)17(22-4)10-8-14(2)7-9-16-12-19-13-18(21)20-16/h8,10,16,19H,2,5-7,9,11-13H2,1,3-4H3,(H,20,21)/b10-8-,17-15- |
| InChIKey | LRZRAPXFBDXXGV-QYUYAQKNSA-N |
| XLogP | 2.66 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|