About ethane;1-methyl-2-methylsulfanyl-4,5-dihydroimidazole
ethane;1-methyl-2-methylsulfanyl-4,5-dihydroimidazole (PubChem CID 143333545) has the molecular formula C7H16N2S
and a molecular weight of 160.29 g/mol. Its IUPAC name is ethane;1-methyl-2-methylsulfanyl-4,5-dihydroimidazole.
Analyze ethane;1-methyl-2-methylsulfanyl-4,5-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-2-methylsulfanyl-4,5-dihydroimidazole?
The IUPAC name of ethane;1-methyl-2-methylsulfanyl-4,5-dihydroimidazole (CID 143333545) is ethane;1-methyl-2-methylsulfanyl-4,5-dihydroimidazole.
What is the SMILES notation for ethane;1-methyl-2-methylsulfanyl-4,5-dihydroimidazole?
The canonical SMILES for ethane;1-methyl-2-methylsulfanyl-4,5-dihydroimidazole is CC.CSC1=NCCN1C.
What is the InChIKey of ethane;1-methyl-2-methylsulfanyl-4,5-dihydroimidazole?
The InChIKey is RBKPWWYWHGTOAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2S.C2H6/c1-7-4-3-6-5(7)8-2;1-2/h3-4H2,1-2H3;1-2H3.
What are the key properties of ethane;1-methyl-2-methylsulfanyl-4,5-dihydroimidazole?
ethane;1-methyl-2-methylsulfanyl-4,5-dihydroimidazole has a molecular weight of 160.29 g/mol, XLogP of 1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-2-methylsulfanyl-4,5-dihydroimidazole is sourced from PubChem (CID 143333545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).