C22H29FN4O2S — CID 143334282
5-[dimethylaminosulfanyl(methyl)amino]-4-ethenyl-2-hydroxy-6-methyl-3-(methylideneamino)benzaldehyde;1-(4-fluorophenyl)-N-methylmethanamine (PubChem CID 143334282) has the molecular formula C22H29FN4O2S and a molecular weight of 432.57 g/mol. Its IUPAC name is 5-[dimethylaminosulfanyl(methyl)amino]-4-ethenyl-2-hydroxy-6-methyl-3-(methylideneamino)benzaldehyde;1-(4-fluorophenyl)-N-methylmethanamine.
| Compound Name | 5-[dimethylaminosulfanyl(methyl)amino]-4-ethenyl-2-hydroxy-6-methyl-3-(methylideneamino)benzaldehyde;1-(4-fluorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 143334282 |
| Molecular Formula | C22H29FN4O2S |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 5-[dimethylaminosulfanyl(methyl)amino]-4-ethenyl-2-hydroxy-6-methyl-3-(methylideneamino)benzaldehyde;1-(4-fluorophenyl)-N-methylmethanamine |
| SMILES | C=Cc1c(N=C)c(O)c(C=O)c(C)c1N(C)SN(C)C.CNCc1ccc(F)cc1 |
| InChI | InChI=1S/C14H19N3O2S.C8H10FN/c1-7-10-12(15-3)14(19)11(8-18)9(2)13(10)17(6)20-16(4)5;1-10-6-7-2-4-8(9)5-3-7/h7-8,19H,1,3H2,2,4-6H3;2-5,10H,6H2,1H3 |
| InChIKey | ULWXBNHJXZRGBP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|