C22H21FN2O3 — CID 143584176
6-[(dimethylamino)methyl]-3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(2-oxoethyl)quinoline-7-carbaldehyde (PubChem CID 143584176) has the molecular formula C22H21FN2O3 and a molecular weight of 380.42 g/mol. Its IUPAC name is 6-[(dimethylamino)methyl]-3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(2-oxoethyl)quinoline-7-carbaldehyde.
| Compound Name | 6-[(dimethylamino)methyl]-3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(2-oxoethyl)quinoline-7-carbaldehyde |
|---|---|
| PubChem CID | 143584176 |
| Molecular Formula | C22H21FN2O3 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 6-[(dimethylamino)methyl]-3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(2-oxoethyl)quinoline-7-carbaldehyde |
| SMILES | CN(C)Cc1c(C=O)c(O)c2ncc(Cc3ccc(F)cc3)cc2c1CC=O |
| InChI | InChI=1S/C22H21FN2O3/c1-25(2)12-19-17(7-8-26)18-10-15(9-14-3-5-16(23)6-4-14)11-24-21(18)22(28)20(19)13-27/h3-6,8,10-11,13,28H,7,9,12H2,1-2H3 |
| InChIKey | GJWYVERBKICHKY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|